Jump to content

Girisopam: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (no changed fields - added verified revid - updated 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoB
 
(27 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
⚫
| verifiedrevid = 444597935
| Watchedfields = changed
⚫
| IUPAC_name = 1-(3-chlorophenyl)- 7,8-dimethoxy- 4-methyl- 5H-2,3-benzodiazepine
⚫
| verifiedrevid = 447996741
⚫
| IUPAC_name = 1-(3-chlorophenyl)-7,8-dimethoxy-4-methyl-5''H''-2,3-benzodiazepine
| image = Girisopam.svg
| image = Girisopam.svg
| width = 180
| width = 200


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| legal_status =
| legal_status =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 82230-53-3
| CAS_number = 82230-53-3
| ATC_prefix = none
| ATC_prefix = none
| PubChem = 71257
| PubChem = 71257
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1915065
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
Line 26: Line 32:


<!--Chemical data-->
<!--Chemical data-->
| C=18 | H=17 | Cl=1 | N=2 | O=2
| C=18 | H=17 | Cl=1 | N=2 | O=2
| molecular_weight = 328.79
| smiles = Clc3cccc(C\2=N\N=C(/Cc1c/2cc(OC)c(OC)c1)C)c3
| smiles = Clc3cccc(C\2=N\N=C(/Cc1c/2cc(OC)c(OC)c1)C)c3
| InChI = 1/C18H17ClN2O2/c1-11-7-13-9-16(22-2)17(23-3)10-15(13)18(21-20-11)12-5-4-6-14(19)8-12/h4-6,8-10H,7H2,1-3H3
| InChIKey = VQYLGVVODFDFNK-UHFFFAOYAK
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H17ClN2O2/c1-11-7-13-9-16(22-2)17(23-3)10-15(13)18(21-20-11)12-5-4-6-14(19)8-12/h4-6,8-10H,7H2,1-3H3
| StdInChI = 1S/C18H17ClN2O2/c1-11-7-13-9-16(22-2)17(23-3)10-15(13)18(21-20-11)12-5-4-6-14(19)8-12/h4-6,8-10H,7H2,1-3H3
Line 37: Line 40:
}}
}}


'''Girisopam''' ('''GYKI-51189''') is a drug which is a 2,3-[[benzodiazepine]] derivative, related to [[tofisopam]].<ref>[http://www.psychotropics.dk/moleculeView/default.aspx?ID=1423&Catalogtype=A&ChapterID=1&Thissortorder=20 Psychotropics.dk]</ref> It has selective [[anxiolytic]] action with no [[sedative]], [[anticonvulsant]] or [[muscle relaxant]] effects.<ref>Andrási F, Horváth K, Sineger E, Berzsenyi P, Borsy J, Kenessey A, Tarr M, Láng T, Kórösi J, Hámori T. Neuropharmacology of a new psychotropic 2,3-benzodiazepine. ''Arzneimittelforschung''. 1987 Oct;37(10):1119-24.</ref><ref>Horváth K, Andrási F, Botka P, Hámori T. Anxiolytic profile of girisopam and GYKI 52,322 (EGIS 6775). Comparison with chlordiazepoxide and buspirone. ''Acta Physiologica Hungarica''. 1992;79(2):153-61.</ref><ref>Horváth EJ, Salamon C, Bakonyi A, Fekete MI, Palkovits M. [(3)H]-girisopam, a novel selective benzodiazepine for the 2, 3-benzodiazepine binding site. ''Brain Research. Brain Research Protocols''. 1999 Jul;4(2):230-5.</ref>
'''Girisopam'''<ref>{{cite patent | country = US | number = 4322346 | title = 5H-2,3-Benzodiazepine derivatives | gdate = 30 March 1982 | inventor = Korosi J, Lang T, Szekely J, Andrasi F, Zolyomi G, Borsi J, Katali G, Hamori T, Gabriella S, Zsuz MN, Miglecz E }}</ref> ('''GYKI-51189''', '''EGIS-5810''') is a drug which is a 2,3-[[benzodiazepine]] derivative, related to [[tofisopam]]<ref name="pmid2893623" /> and [[zometapine]]. It has selective [[anxiolytic]] action with no [[sedative]], [[anticonvulsant]] or [[muscle relaxant]] effects.<ref name="pmid2893623">{{cite journal | vauthors = Andrási F, Horváth K, Sineger E, Berzsenyi P, Borsy J, Kenessey A, Tarr M, Láng T, Kórösi J, Hámori T | title = Neuropharmacology of a new psychotropic 2,3-benzodiazepine | journal = Arzneimittel-Forschung | volume = 37 | issue = 10 | pages = 1119–24 | date = October 1987 | pmid = 2893623 }}</ref><ref name="pmid1363928">{{cite journal | vauthors = Horváth K, Andrási F, Botka P, Hámori T | title = Anxiolytic profile of girisopam and GYKI 52,322 (EGIS 6775). Comparison with chlordiazepoxide and buspirone | journal = Acta Physiologica Hungarica | volume = 79 | issue = 2 | pages = 153–61 | date = 1992 | pmid = 1363928 }}</ref><ref name="pmid10446419">{{cite journal | vauthors = Horváth EJ, Salamon C, Bakonyi A, Fekete MI, Palkovits M | title = [(3)H]-girisopam, a novel selective benzodiazepine for the 2, 3-benzodiazepine binding site | journal = Brain Research. Brain Research Protocols | volume = 4 | issue = 2 | pages = 230–5 | date = July 1999 | pmid = 10446419 | doi = 10.1016/s1385-299x(99)00025-2 }}</ref>


== See also ==
== See also ==
Line 44: Line 47:
== References ==
== References ==
{{Reflist|2}}
{{Reflist|2}}



{{Anxiolytics}}
{{Anxiolytics}}
Line 50: Line 52:


[[Category:Benzodiazepines]]
[[Category:Benzodiazepines]]
[[Category:Organochlorides]]
[[Category:3-Chlorophenyl compounds]]
[[Category:Phenol ethers]]
[[Category:Phenol ethers]]


{{Anxiolytic-stub}}

{{nervous-system-drug-stub}}

[[pl:Girizopam]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"